![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 00.Preface | 2006-07-20 09:42 | 48K | |
| 01.Elements | 2006-07-20 09:42 | 155K | |
| 02.Structure | 2006-07-20 09:42 | 288K | |
| 03.Earth and the Oth..> | 2006-07-20 09:42 | 209K | |
| 04.Discovery | 2006-07-20 09:42 | 386K | |
| 05.The Atmosphere | 2006-07-20 09:42 | 1.7M | |
| 06.Carbon Dioxide an..> | 2006-07-20 09:42 | 217K | |
| 07.Bodies of Water | 2006-07-20 09:42 | 402K | |
| 08.Carbonates in the..> | 2006-07-20 09:42 | 728K | |
| 09.Volcanoes | 2006-07-20 09:42 | 1.0M | |
| 10.Photosynthesis | 2006-07-20 09:42 | 502K | |
| 11.Respiration and M..> | 2006-07-20 09:42 | 341K | |
| 12.Fossil Fuels | 2006-07-20 09:42 | 360K | |
| 13.Food and Drink | 2006-07-20 09:42 | 430K | |
| 14.Sequestration | 2006-07-20 09:42 | 135K | |
| 15.Isotope Records | 2006-07-20 09:42 | 307K | |
| Bibliography | 2006-07-20 09:42 | 24K | |