![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| slurring small.jpg | 2024-05-13 15:01 | 18K | |
| poetry small.jpg | 2024-05-13 15:01 | 40K | |
| janos small.jpg | 2024-05-13 15:01 | 35K | |
| destination moon han..> | 2024-05-13 15:01 | 15K | |
| abdc.jpg | 2024-05-13 15:01 | 37K | |
| Tunnel Map small.jpg | 2024-05-13 15:01 | 61K | |
| Tunnel Map Text.gif | 2024-05-13 15:01 | 2.2K | |
| Treading the Maze sm..> | 2024-05-13 15:01 | 20K | |
| Treading the Maze Te..> | 2024-05-13 15:01 | 3.2K | |
| Title Bar Directory ..> | 2024-05-13 15:01 | 70K | |
| Thumbs.db | 2024-05-13 15:01 | 132K | |
| The Guerilla Art Kit..> | 2024-05-13 15:01 | 36K | |
| That C Word small.jpg | 2024-05-13 15:01 | 54K | |
| That C Word Text.gif | 2024-05-13 15:01 | 2.5K | |
| Slurring Text.gif | 2024-05-13 15:01 | 2.7K | |
| Site Readings small.jpg | 2024-05-13 15:01 | 41K | |
| Site Readings Text.gif | 2024-05-13 15:01 | 1.8K | |
| Seance for a Minyan ..> | 2024-05-13 15:01 | 20K | |
| Seance Text.gif | 2024-05-13 15:01 | 2.9K | |
| Poetry Text.gif | 2024-05-13 15:01 | 2.4K | |
| Paris out of Hand sm..> | 2024-05-13 15:01 | 22K | |
| Paris Out of Hand Te..> | 2024-05-13 15:01 | 3.6K | |
| Owl-phabet of art sm..> | 2024-05-13 15:01 | 29K | |
| Owl-phabet of Art Te..> | 2024-05-13 15:01 | 2.1K | |
| Janos Text.gif | 2024-05-13 15:01 | 2.5K | |
| Guerilla Art Kit Tex..> | 2024-05-13 15:01 | 2.4K | |
| Florence small.jpg | 2024-05-13 15:01 | 32K | |
| Florence Text.gif | 2024-05-13 15:01 | 2.0K | |
| Destination Moon Tex..> | 2024-05-13 15:01 | 2.1K | |
| Common Monsters smal..> | 2024-05-13 15:01 | 31K | |
| Common Monsters Text..> | 2024-05-13 15:01 | 2.9K | |
| Chemical Ways small.jpg | 2024-05-13 15:01 | 41K | |
| Chemical Ways Text.gif | 2024-05-13 15:01 | 1.8K | |
| ArtistsBookIndex.html | 2024-05-13 15:01 | 83K | |
| 2000 Dragons small.jpg | 2024-05-13 15:01 | 34K | |
| 2000 Dragons Text.gif | 2024-05-13 15:01 | 2.2K | |
